C27H31F3N4O2 — CID 78041519
2-N-(5-phenyl-1,3-oxazol-2-yl)-1-N-[1-[4-(trifluoromethoxy)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine (PubChem CID 78041519) has the molecular formula C27H31F3N4O2 and a molecular weight of 500.57 g/mol. Its IUPAC name is 2-N-(5-phenyl-1,3-oxazol-2-yl)-1-N-[1-[4-(trifluoromethoxy)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine.
| Compound Name | 2-N-(5-phenyl-1,3-oxazol-2-yl)-1-N-[1-[4-(trifluoromethoxy)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 78041519 |
| Molecular Formula | C27H31F3N4O2 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-N-(5-phenyl-1,3-oxazol-2-yl)-1-N-[1-[4-(trifluoromethoxy)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine |
| SMILES | FC(F)(F)Oc1ccc(N2CCCC(NC3CCCCC3Nc3ncc(-c4ccccc4)o3)C2)cc1 |
| InChI | InChI=1S/C27H31F3N4O2/c28-27(29,30)36-22-14-12-21(13-15-22)34-16-6-9-20(18-34)32-23-10-4-5-11-24(23)33-26-31-17-25(35-26)19-7-2-1-3-8-19/h1-3,7-8,12-15,17,20,23-24,32H,4-6,9-11,16,18H2,(H,31,33) |
| InChIKey | FQZOPVPGZZUDEW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|