C27H29F4N5O4 — CID 140611920
2-N-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]cyclohexane-1,2-diamine (PubChem CID 140611920) has the molecular formula C27H29F4N5O4 and a molecular weight of 563.55 g/mol. Its IUPAC name is 2-N-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]cyclohexane-1,2-diamine.
| Compound Name | 2-N-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 140611920 |
| Molecular Formula | C27H29F4N5O4 |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 2-N-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]cyclohexane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC[C@H](NC3CCCCC3Nc3ncc(-c4ccc(OC(F)(F)F)c(F)c4)o3)C2)cc1 |
| InChI | InChI=1S/C27H29F4N5O4/c28-21-14-17(7-12-24(21)40-27(29,30)31)25-15-32-26(39-25)34-23-6-2-1-5-22(23)33-18-4-3-13-35(16-18)19-8-10-20(11-9-19)36(37)38/h7-12,14-15,18,22-23,33H,1-6,13,16H2,(H,32,34)/t18-,22?,23?/m0/s1 |
| InChIKey | VIWYDNQNGCBXMT-NWLLBJEDSA-N |
| XLogP | 6.27 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|