C28H32F3N5O4 — CID 140611862
2-N-[(3S)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]-1-N-[5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]cyclohexane-1,2-diamine (PubChem CID 140611862) has the molecular formula C28H32F3N5O4 and a molecular weight of 559.59 g/mol. Its IUPAC name is 2-N-[(3S)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]-1-N-[5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]cyclohexane-1,2-diamine.
| Compound Name | 2-N-[(3S)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]-1-N-[5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 140611862 |
| Molecular Formula | C28H32F3N5O4 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 2-N-[(3S)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]-1-N-[5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-yl]cyclohexane-1,2-diamine |
| SMILES | C[C@]1(NC2CCCCC2Nc2ncc(-c3ccc(OC(F)(F)F)cc3)o2)CCCN(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C28H32F3N5O4/c1-27(15-4-16-35(18-27)20-9-11-21(12-10-20)36(37)38)34-24-6-3-2-5-23(24)33-26-32-17-25(39-26)19-7-13-22(14-8-19)40-28(29,30)31/h7-14,17,23-24,34H,2-6,15-16,18H2,1H3,(H,32,33)/t23?,24?,27-/m0/s1 |
| InChIKey | RRWYIRCOHLMDJF-CXTIUDGFSA-N |
| XLogP | 6.52 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|