C25H30N6O3 — CID 159873090
N-[(1R,2S)-2-[[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine (PubChem CID 159873090) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine.
| Compound Name | N-[(1R,2S)-2-[[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 159873090 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[(1R,2S)-2-[[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(N2CCC[C@H](C[C@@H]3CCCC[C@H]3Nc3ncc(-c4ccccc4)o3)C2)nc1 |
| InChI | InChI=1S/C25H30N6O3/c32-31(33)21-14-26-24(27-15-21)30-12-6-7-18(17-30)13-20-10-4-5-11-22(20)29-25-28-16-23(34-25)19-8-2-1-3-9-19/h1-3,8-9,14-16,18,20,22H,4-7,10-13,17H2,(H,28,29)/t18-,20+,22-/m1/s1 |
| InChIKey | NSODQQSRMMNOHS-KAGYGMCKSA-N |
| XLogP | 5.32 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|