C28H32N4O3 — CID 159950672
N-[(1R,2S)-2-[[(1R,4R,6R)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine (PubChem CID 159950672) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[(1R,4R,6R)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine.
| Compound Name | N-[(1R,2S)-2-[[(1R,4R,6R)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 159950672 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[(1R,2S)-2-[[(1R,4R,6R)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]-5-phenyl-1,3-oxazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N2C[C@@H]3C[C@H](C[C@@H]4CCCC[C@H]4Nc4ncc(-c5ccccc5)o4)[C@H]2C3)cc1 |
| InChI | InChI=1S/C28H32N4O3/c33-32(34)24-12-10-23(11-13-24)31-18-19-14-22(26(31)15-19)16-21-8-4-5-9-25(21)30-28-29-17-27(35-28)20-6-2-1-3-7-20/h1-3,6-7,10-13,17,19,21-22,25-26H,4-5,8-9,14-16,18H2,(H,29,30)/t19-,21+,22-,25-,26-/m1/s1 |
| InChIKey | OCBLGVZZWUMEOQ-ZMJYYMGBSA-N |
| XLogP | 6.53 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|