C29H33F3N4O4 — CID 162106772
N-[(1R,2S)-2-[[(3R)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine (PubChem CID 162106772) has the molecular formula C29H33F3N4O4 and a molecular weight of 558.60 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[(3R)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine.
| Compound Name | N-[(1R,2S)-2-[[(3R)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 162106772 |
| Molecular Formula | C29H33F3N4O4 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | N-[(1R,2S)-2-[[(3R)-3-methyl-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine |
| SMILES | C[C@]1(C[C@@H]2CCCC[C@H]2Nc2ncc(-c3ccc(OC(F)(F)F)cc3)o2)CCCN(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C29H33F3N4O4/c1-28(15-4-16-35(19-28)22-9-11-23(12-10-22)36(37)38)17-21-5-2-3-6-25(21)34-27-33-18-26(39-27)20-7-13-24(14-8-20)40-29(30,31)32/h7-14,18,21,25H,2-6,15-17,19H2,1H3,(H,33,34)/t21-,25+,28+/m0/s1 |
| InChIKey | ZFPOAEQCBUOFTF-GOEWEAILSA-N |
| XLogP | 7.82 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|