C29H32F3N5O3 — CID 71227156
trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]cyclohexane-1,2-diamine (PubChem CID 71227156) has the molecular formula C29H32F3N5O3 and a molecular weight of 555.60 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71227156 |
| Molecular Formula | C29H32F3N5O3 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]cyclohexane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC[C@H](N[C@@H]3CCCC[C@H]3Nc3cc(-c4ccc(OC(F)(F)F)cc4)ccn3)C2)cc1 |
| InChI | InChI=1S/C29H32F3N5O3/c30-29(31,32)40-25-13-7-20(8-14-25)21-15-16-33-28(18-21)35-27-6-2-1-5-26(27)34-22-4-3-17-36(19-22)23-9-11-24(12-10-23)37(38)39/h7-16,18,22,26-27,34H,1-6,17,19H2,(H,33,35)/t22-,26+,27+/m0/s1 |
| InChIKey | PKUASVFLJIOXGZ-ZDJNHPEVSA-N |
| XLogP | 6.54 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|