C26H31N5O2S — CID 89389533
trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-(5-phenyl-1,3-thiazol-2-yl)cyclohexane-1,2-diamine (PubChem CID 89389533) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-(5-phenyl-1,3-thiazol-2-yl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-(5-phenyl-1,3-thiazol-2-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 89389533 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | trans-(1R,2R)-1-N-[(3S)-1-(4-nitrophenyl)piperidin-3-yl]-2-N-(5-phenyl-1,3-thiazol-2-yl)cyclohexane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC[C@H](N[C@@H]3CCCC[C@H]3Nc3ncc(-c4ccccc4)s3)C2)cc1 |
| InChI | InChI=1S/C26H31N5O2S/c32-31(33)22-14-12-21(13-15-22)30-16-6-9-20(18-30)28-23-10-4-5-11-24(23)29-26-27-17-25(34-26)19-7-2-1-3-8-19/h1-3,7-8,12-15,17,20,23-24,28H,4-6,9-11,16,18H2,(H,27,29)/t20-,23+,24+/m0/s1 |
| InChIKey | DOQHFEPMOWWBQO-TUACAJSNSA-N |
| XLogP | 5.70 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|