C28H31F3N4O4 — CID 147753584
N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine (PubChem CID 147753584) has the molecular formula C28H31F3N4O4 and a molecular weight of 544.57 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine.
| Compound Name | N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 147753584 |
| Molecular Formula | C28H31F3N4O4 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC[C@H](C[C@@H]3CCCC[C@H]3Nc3ncc(-c4cccc(OC(F)(F)F)c4)o3)C2)cc1 |
| InChI | InChI=1S/C28H31F3N4O4/c29-28(30,31)39-24-8-3-7-21(16-24)26-17-32-27(38-26)33-25-9-2-1-6-20(25)15-19-5-4-14-34(18-19)22-10-12-23(13-11-22)35(36)37/h3,7-8,10-13,16-17,19-20,25H,1-2,4-6,9,14-15,18H2,(H,32,33)/t19-,20+,25-/m1/s1 |
| InChIKey | HCRFWKFUCGLEKS-OHUGHZGNSA-N |
| XLogP | 7.43 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|