C30H35N7O2 — CID 147872636
3-[2-[[(1R,2S)-2-[[(3R)-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-3-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide (PubChem CID 147872636) has the molecular formula C30H35N7O2 and a molecular weight of 525.66 g/mol. Its IUPAC name is 3-[2-[[(1R,2S)-2-[[(3R)-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-3-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide.
| Compound Name | 3-[2-[[(1R,2S)-2-[[(3R)-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-3-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 147872636 |
| Molecular Formula | C30H35N7O2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 3-[2-[[(1R,2S)-2-[[(3R)-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-3-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2cnc(N[C@@H]3CCCC[C@H]3C[C@H]3CCCN(c4ccc(-n5cncn5)cc4)C3)o2)c1 |
| InChI | InChI=1S/C30H35N7O2/c31-29(38)24-8-3-7-23(16-24)28-17-33-30(39-28)35-27-9-2-1-6-22(27)15-21-5-4-14-36(18-21)25-10-12-26(13-11-25)37-20-32-19-34-37/h3,7-8,10-13,16-17,19-22,27H,1-2,4-6,9,14-15,18H2,(H2,31,38)(H,33,35)/t21-,22+,27-/m1/s1 |
| InChIKey | HYXCWWGDXQBBJE-UMTXDNHDSA-N |
| XLogP | 5.30 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|