C28H31N7O2 — CID 158430194
3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-(5-cyanopyrimidin-2-yl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide (PubChem CID 158430194) has the molecular formula C28H31N7O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-(5-cyanopyrimidin-2-yl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide.
| Compound Name | 3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-(5-cyanopyrimidin-2-yl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 158430194 |
| Molecular Formula | C28H31N7O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-(5-cyanopyrimidin-2-yl)-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide |
| SMILES | N#Cc1cnc(N2C[C@@H]3C[C@H](C[C@@H]4CCCC[C@H]4Nc4ncc(-c5cccc(C(N)=O)c5)o4)[C@H]2C3)nc1 |
| InChI | InChI=1S/C28H31N7O2/c29-12-18-13-31-27(32-14-18)35-16-17-8-22(24(35)9-17)10-19-4-1-2-7-23(19)34-28-33-15-25(37-28)20-5-3-6-21(11-20)26(30)36/h3,5-6,11,13-15,17,19,22-24H,1-2,4,7-10,16H2,(H2,30,36)(H,33,34)/t17-,19+,22-,23-,24-/m1/s1 |
| InChIKey | HBOFPQBIEFAYGC-BAKSZIAMSA-N |
| XLogP | 4.38 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |