C34H38N6O2 — CID 162186591
3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-4-pyridinyl]benzamide (PubChem CID 162186591) has the molecular formula C34H38N6O2 and a molecular weight of 562.72 g/mol. Its IUPAC name is 3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-4-pyridinyl]benzamide.
| Compound Name | 3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 162186591 |
| Molecular Formula | C34H38N6O2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 3-[2-[[(1R,2S)-2-[[(1R,4R,6R)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-azabicyclo[2.2.1]heptan-6-yl]methyl]cyclohexyl]amino]-4-pyridinyl]benzamide |
| SMILES | Cc1nc(-c2ccc(N3C[C@@H]4C[C@H](C[C@@H]5CCCC[C@H]5Nc5cc(-c6cccc(C(N)=O)c6)ccn5)[C@H]3C4)cc2)no1 |
| InChI | InChI=1S/C34H38N6O2/c1-21-37-34(39-42-21)23-9-11-29(12-10-23)40-20-22-15-28(31(40)16-22)18-26-5-2-3-8-30(26)38-32-19-25(13-14-36-32)24-6-4-7-27(17-24)33(35)41/h4,6-7,9-14,17,19,22,26,28,30-31H,2-3,5,8,15-16,18,20H2,1H3,(H2,35,41)(H,36,38)/t22-,26+,28-,30-,31-/m1/s1 |
| InChIKey | ZPSRLFOCCNTESA-HIHYHTMBSA-N |
| XLogP | 6.48 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |