C28H33N5O2 — CID 157439335
N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-4-phenylpyrimidin-2-amine (PubChem CID 157439335) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-4-phenylpyrimidin-2-amine.
| Compound Name | N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-4-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 157439335 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-[(1R,2S)-2-[[(3R)-1-(4-nitrophenyl)piperidin-3-yl]methyl]cyclohexyl]-4-phenylpyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC[C@H](C[C@@H]3CCCC[C@H]3Nc3nccc(-c4ccccc4)n3)C2)cc1 |
| InChI | InChI=1S/C28H33N5O2/c34-33(35)25-14-12-24(13-15-25)32-18-6-7-21(20-32)19-23-10-4-5-11-26(23)30-28-29-17-16-27(31-28)22-8-2-1-3-9-22/h1-3,8-9,12-17,21,23,26H,4-7,10-11,18-20H2,(H,29,30,31)/t21-,23+,26-/m1/s1 |
| InChIKey | BRMDBHRAOSWIRV-VIICAESSSA-N |
| XLogP | 6.33 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|