C28H36N6 — CID 89394068
trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(4-aminophenyl)-2-pyridinyl]cyclohexane-1,2-diamine (PubChem CID 89394068) has the molecular formula C28H36N6 and a molecular weight of 456.64 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(4-aminophenyl)-2-pyridinyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(4-aminophenyl)-2-pyridinyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 89394068 |
| Molecular Formula | C28H36N6 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(4-aminophenyl)-2-pyridinyl]cyclohexane-1,2-diamine |
| SMILES | Nc1ccc(-c2ccnc(N[C@@H]3CCCC[C@H]3N[C@H]3CCCN(c4ccc(N)cc4)C3)c2)cc1 |
| InChI | InChI=1S/C28H36N6/c29-22-9-7-20(8-10-22)21-15-16-31-28(18-21)33-27-6-2-1-5-26(27)32-24-4-3-17-34(19-24)25-13-11-23(30)12-14-25/h7-16,18,24,26-27,32H,1-6,17,19,29-30H2,(H,31,33)/t24-,26+,27+/m0/s1 |
| InChIKey | LGDZLSARZKIFRS-WYMJOSIYSA-N |
| XLogP | 4.89 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|