C30H39N5O — CID 89394082
(1R)-1-[3-[2-[[(1R,2R)-2-[[(3S)-1-(4-aminophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]phenyl]ethanol (PubChem CID 89394082) has the molecular formula C30H39N5O and a molecular weight of 485.68 g/mol. Its IUPAC name is (1R)-1-[3-[2-[[(1R,2R)-2-[[(3S)-1-(4-aminophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]phenyl]ethanol.
| Compound Name | (1R)-1-[3-[2-[[(1R,2R)-2-[[(3S)-1-(4-aminophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]phenyl]ethanol |
|---|---|
| PubChem CID | 89394082 |
| Molecular Formula | C30H39N5O |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | (1R)-1-[3-[2-[[(1R,2R)-2-[[(3S)-1-(4-aminophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]phenyl]ethanol |
| SMILES | C[C@@H](O)c1cccc(-c2ccnc(N[C@@H]3CCCC[C@H]3N[C@H]3CCCN(c4ccc(N)cc4)C3)c2)c1 |
| InChI | InChI=1S/C30H39N5O/c1-21(36)22-6-4-7-23(18-22)24-15-16-32-30(19-24)34-29-10-3-2-9-28(29)33-26-8-5-17-35(20-26)27-13-11-25(31)12-14-27/h4,6-7,11-16,18-19,21,26,28-29,33,36H,2-3,5,8-10,17,20,31H2,1H3,(H,32,34)/t21-,26+,28-,29-/m1/s1 |
| InChIKey | ZECXYUMLFACKRY-HSYZXZFHSA-N |
| XLogP | 5.37 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|