C29H35N7 — CID 89394123
trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(1H-indazol-4-yl)-2-pyridinyl]cyclohexane-1,2-diamine (PubChem CID 89394123) has the molecular formula C29H35N7 and a molecular weight of 481.65 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(1H-indazol-4-yl)-2-pyridinyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(1H-indazol-4-yl)-2-pyridinyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 89394123 |
| Molecular Formula | C29H35N7 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | trans-(1R,2R)-1-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-2-N-[4-(1H-indazol-4-yl)-2-pyridinyl]cyclohexane-1,2-diamine |
| SMILES | Nc1ccc(N2CCC[C@H](N[C@@H]3CCCC[C@H]3Nc3cc(-c4cccc5[nH]ncc45)ccn3)C2)cc1 |
| InChI | InChI=1S/C29H35N7/c30-21-10-12-23(13-11-21)36-16-4-5-22(19-36)33-27-7-1-2-8-28(27)34-29-17-20(14-15-31-29)24-6-3-9-26-25(24)18-32-35-26/h3,6,9-15,17-18,22,27-28,33H,1-2,4-5,7-8,16,19,30H2,(H,31,34)(H,32,35)/t22-,27+,28+/m0/s1 |
| InChIKey | ZVGYINXBAHIIJY-XDAJTCOGSA-N |
| XLogP | 5.19 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|