C26H32N6O — CID 123137517
3-[2-[[(1R,2R)-2-[[(3S)-1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enamide (PubChem CID 123137517) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is 3-[2-[[(1R,2R)-2-[[(3S)-1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enamide.
| Compound Name | 3-[2-[[(1R,2R)-2-[[(3S)-1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 123137517 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 3-[2-[[(1R,2R)-2-[[(3S)-1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enamide |
| SMILES | N#Cc1ccc(N2CCC[C@H](N[C@@H]3CCCC[C@H]3Nc3cc(C=CC(N)=O)ccn3)C2)cc1 |
| InChI | InChI=1S/C26H32N6O/c27-17-20-7-10-22(11-8-20)32-15-3-4-21(18-32)30-23-5-1-2-6-24(23)31-26-16-19(13-14-29-26)9-12-25(28)33/h7-14,16,21,23-24,30H,1-6,15,18H2,(H2,28,33)(H,29,31)/t21-,23+,24+/m0/s1 |
| InChIKey | BJTILUGUOUPIMC-QPTUXGOLSA-N |
| XLogP | 3.43 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|