C30H39N5O2 — CID 78041600
tert-butyl 3-[2-[[2-[[1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enoate (PubChem CID 78041600) has the molecular formula C30H39N5O2 and a molecular weight of 501.68 g/mol. Its IUPAC name is tert-butyl 3-[2-[[2-[[1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[2-[[2-[[1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 78041600 |
| Molecular Formula | C30H39N5O2 |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | tert-butyl 3-[2-[[2-[[1-(4-cyanophenyl)piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1ccnc(NC2CCCCC2NC2CCCN(c3ccc(C#N)cc3)C2)c1 |
| InChI | InChI=1S/C30H39N5O2/c1-30(2,3)37-29(36)15-12-22-16-17-32-28(19-22)34-27-9-5-4-8-26(27)33-24-7-6-18-35(21-24)25-13-10-23(20-31)11-14-25/h10-17,19,24,26-27,33H,4-9,18,21H2,1-3H3,(H,32,34) |
| InChIKey | YSCVDHHKHKDTPH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|