C27H37N3 — CID 144514368
N-[(3E)-3-methylpenta-1,3-dien-2-yl]-2-[4-[(3E,5Z)-octa-3,5,7-trien-3-yl]piperazin-1-yl]-5-prop-1-en-2-ylaniline (PubChem CID 144514368) has the molecular formula C27H37N3 and a molecular weight of 403.61 g/mol. Its IUPAC name is N-[(3E)-3-methylpenta-1,3-dien-2-yl]-2-[4-[(3E,5Z)-octa-3,5,7-trien-3-yl]piperazin-1-yl]-5-prop-1-en-2-ylaniline.
| Compound Name | N-[(3E)-3-methylpenta-1,3-dien-2-yl]-2-[4-[(3E,5Z)-octa-3,5,7-trien-3-yl]piperazin-1-yl]-5-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 144514368 |
| Molecular Formula | C27H37N3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.30 |
| IUPAC Name | N-[(3E)-3-methylpenta-1,3-dien-2-yl]-2-[4-[(3E,5Z)-octa-3,5,7-trien-3-yl]piperazin-1-yl]-5-prop-1-en-2-ylaniline |
| SMILES | C=C/C=C\C=C(/CC)N1CCN(c2ccc(C(=C)C)cc2NC(=C)/C(C)=C/C)CC1 |
| InChI | InChI=1S/C27H37N3/c1-8-11-12-13-25(10-3)29-16-18-30(19-17-29)27-15-14-24(21(4)5)20-26(27)28-23(7)22(6)9-2/h8-9,11-15,20,28H,1,4,7,10,16-19H2,2-3,5-6H3/b12-11-,22-9+,25-13+ |
| InChIKey | IUOBPZJEMAKFOW-CAZZYAGESA-N |
| XLogP | 6.77 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|