C36H49N5O3 — CID 130372932
N-[5-[[(2E,3Z)-2-[3-(dimethylamino)-2-methylpropylidene]hexa-3,5-dienyl]carbamoyl]-2-[4-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]piperazin-1-yl]phenyl]-5-methylfuran-2-carboxamide (PubChem CID 130372932) has the molecular formula C36H49N5O3 and a molecular weight of 599.82 g/mol. Its IUPAC name is N-[5-[[(2E,3Z)-2-[3-(dimethylamino)-2-methylpropylidene]hexa-3,5-dienyl]carbamoyl]-2-[4-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]piperazin-1-yl]phenyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[5-[[(2E,3Z)-2-[3-(dimethylamino)-2-methylpropylidene]hexa-3,5-dienyl]carbamoyl]-2-[4-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]piperazin-1-yl]phenyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 130372932 |
| Molecular Formula | C36H49N5O3 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.38 |
| IUPAC Name | N-[5-[[(2E,3Z)-2-[3-(dimethylamino)-2-methylpropylidene]hexa-3,5-dienyl]carbamoyl]-2-[4-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]piperazin-1-yl]phenyl]-5-methylfuran-2-carboxamide |
| SMILES | C=C/C=C\C(=C/C(C)CN(C)C)CNC(=O)c1ccc(N2CCN(/C(C)=C(C)/C=C\C)CC2)c(NC(=O)c2ccc(C)o2)c1 |
| InChI | InChI=1S/C36H49N5O3/c1-9-11-13-30(22-26(3)25-39(7)8)24-37-35(42)31-15-16-33(32(23-31)38-36(43)34-17-14-28(5)44-34)41-20-18-40(19-21-41)29(6)27(4)12-10-2/h9-17,22-23,26H,1,18-21,24-25H2,2-8H3,(H,37,42)(H,38,43)/b12-10-,13-11-,29-27+,30-22+ |
| InChIKey | NUBHVKYYSXOMOW-FQPUSGCESA-N |
| XLogP | 6.43 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|