C35H47N5O5 — CID 71236149
tert-butyl N-[6-[[3-[(5-methylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]hexyl]carbamate (PubChem CID 71236149) has the molecular formula C35H47N5O5 and a molecular weight of 617.79 g/mol. Its IUPAC name is tert-butyl N-[6-[[3-[(5-methylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[3-[(5-methylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 71236149 |
| Molecular Formula | C35H47N5O5 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.36 |
| IUPAC Name | tert-butyl N-[6-[[3-[(5-methylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]hexyl]carbamate |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(=O)NCCCCCCNC(=O)OC(C)(C)C)ccc2N2CCN(c3ccccc3C)CC2)o1 |
| InChI | InChI=1S/C35H47N5O5/c1-25-12-8-9-13-29(25)39-20-22-40(23-21-39)30-16-15-27(24-28(30)38-33(42)31-17-14-26(2)44-31)32(41)36-18-10-6-7-11-19-37-34(43)45-35(3,4)5/h8-9,12-17,24H,6-7,10-11,18-23H2,1-5H3,(H,36,41)(H,37,43)(H,38,42) |
| InChIKey | AJJOHNPXSILAFC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|