C25H31N5O3 — CID 130372974
N-[5-(3-aminopropylcarbamoyl)-2-[2-(2-methylanilino)ethylamino]phenyl]-5-methylfuran-2-carboxamide (PubChem CID 130372974) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-[5-(3-aminopropylcarbamoyl)-2-[2-(2-methylanilino)ethylamino]phenyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[5-(3-aminopropylcarbamoyl)-2-[2-(2-methylanilino)ethylamino]phenyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 130372974 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | N-[5-(3-aminopropylcarbamoyl)-2-[2-(2-methylanilino)ethylamino]phenyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(=O)NCCCN)ccc2NCCNc2ccccc2C)o1 |
| InChI | InChI=1S/C25H31N5O3/c1-17-6-3-4-7-20(17)27-14-15-28-21-10-9-19(24(31)29-13-5-12-26)16-22(21)30-25(32)23-11-8-18(2)33-23/h3-4,6-11,16,27-28H,5,12-15,26H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | MWMYVCDFBUHYJH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|