C30H36N6O4 — CID 71488103
N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[3-(prop-2-enylcarbamoylamino)propylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 71488103) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[3-(prop-2-enylcarbamoylamino)propylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[3-(prop-2-enylcarbamoylamino)propylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71488103 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[3-(prop-2-enylcarbamoylamino)propylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | C=CCNC(=O)NCCCNC(=O)c1ccc(N2CCN(c3ccccc3C)CC2)c(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C30H36N6O4/c1-3-13-32-30(39)33-15-7-14-31-28(37)23-11-12-26(24(21-23)34-29(38)27-10-6-20-40-27)36-18-16-35(17-19-36)25-9-5-4-8-22(25)2/h3-6,8-12,20-21H,1,7,13-19H2,2H3,(H,31,37)(H,34,38)(H2,32,33,39) |
| InChIKey | DIBJMGVLDGKHAX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|