C27H33N5O3 — CID 130372949
N-[5-(butylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 130372949) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[5-(butylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[5-(butylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 130372949 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | N-[5-(butylcarbamoyl)-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(N2CCN(c3ccccc3C)CC2)c(NC(=O)c2coc(C)n2)c1 |
| InChI | InChI=1S/C27H33N5O3/c1-4-5-12-28-26(33)21-10-11-25(22(17-21)30-27(34)23-18-35-20(3)29-23)32-15-13-31(14-16-32)24-9-7-6-8-19(24)2/h6-11,17-18H,4-5,12-16H2,1-3H3,(H,28,33)(H,30,34) |
| InChIKey | WBTSZBOVIWLPEN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|