C29H39N5O2 — CID 130372728
N-butyl-4-[4-(2-methylphenyl)piperazin-1-yl]-3-[[(Z)-2-(propan-2-ylideneamino)but-2-enoyl]amino]benzamide (PubChem CID 130372728) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-butyl-4-[4-(2-methylphenyl)piperazin-1-yl]-3-[[(Z)-2-(propan-2-ylideneamino)but-2-enoyl]amino]benzamide.
| Compound Name | N-butyl-4-[4-(2-methylphenyl)piperazin-1-yl]-3-[[(Z)-2-(propan-2-ylideneamino)but-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 130372728 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | N-butyl-4-[4-(2-methylphenyl)piperazin-1-yl]-3-[[(Z)-2-(propan-2-ylideneamino)but-2-enoyl]amino]benzamide |
| SMILES | C/C=C(\N=C(C)C)C(=O)Nc1cc(C(=O)NCCCC)ccc1N1CCN(c2ccccc2C)CC1 |
| InChI | InChI=1S/C29H39N5O2/c1-6-8-15-30-28(35)23-13-14-27(25(20-23)32-29(36)24(7-2)31-21(3)4)34-18-16-33(17-19-34)26-12-10-9-11-22(26)5/h7,9-14,20H,6,8,15-19H2,1-5H3,(H,30,35)(H,32,36)/b24-7- |
| InChIKey | CBAFVNBWGDQUMU-VAPIAZESSA-N |
| XLogP | 5.17 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|