C39H54N4 — CID 144514353
5-[1-(butylamino)ethenyl]-N-[1-(2-methylphenyl)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]aniline;2-methylhex-1-ene (PubChem CID 144514353) has the molecular formula C39H54N4 and a molecular weight of 578.89 g/mol. Its IUPAC name is 5-[1-(butylamino)ethenyl]-N-[1-(2-methylphenyl)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]aniline;2-methylhex-1-ene.
| Compound Name | 5-[1-(butylamino)ethenyl]-N-[1-(2-methylphenyl)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]aniline;2-methylhex-1-ene |
|---|---|
| PubChem CID | 144514353 |
| Molecular Formula | C39H54N4 |
| Molecular Weight | 578.89 g/mol |
| Exact Mass | 578.43 |
| IUPAC Name | 5-[1-(butylamino)ethenyl]-N-[1-(2-methylphenyl)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]aniline;2-methylhex-1-ene |
| SMILES | C=C(C)CCCC.C=C(NCCCC)c1ccc(N2CCN(c3ccccc3C)CC2)c(NC(=C)c2ccccc2C)c1 |
| InChI | InChI=1S/C32H40N4.C7H14/c1-6-7-18-33-26(4)28-16-17-32(30(23-28)34-27(5)29-14-10-8-12-24(29)2)36-21-19-35(20-22-36)31-15-11-9-13-25(31)3;1-4-5-6-7(2)3/h8-17,23,33-34H,4-7,18-22H2,1-3H3;2,4-6H2,1,3H3 |
| InChIKey | HEHLKCDNRMDXAF-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.89 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|