C38H56N4OS — CID 144513839
(E)-N-[5-[1-(butylamino)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-3-methylsulfanyl-2-prop-1-en-2-ylbut-2-enamide;2-methylhex-1-ene (PubChem CID 144513839) has the molecular formula C38H56N4OS and a molecular weight of 616.96 g/mol. Its IUPAC name is (E)-N-[5-[1-(butylamino)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-3-methylsulfanyl-2-prop-1-en-2-ylbut-2-enamide;2-methylhex-1-ene.
| Compound Name | (E)-N-[5-[1-(butylamino)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-3-methylsulfanyl-2-prop-1-en-2-ylbut-2-enamide;2-methylhex-1-ene |
|---|---|
| PubChem CID | 144513839 |
| Molecular Formula | C38H56N4OS |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.42 |
| IUPAC Name | (E)-N-[5-[1-(butylamino)ethenyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-3-methylsulfanyl-2-prop-1-en-2-ylbut-2-enamide;2-methylhex-1-ene |
| SMILES | C=C(C)/C(C(=O)Nc1cc(C(=C)NCCCC)ccc1N1CCN(c2ccccc2C)CC1)=C(/C)SC.C=C(C)CCCC |
| InChI | InChI=1S/C31H42N4OS.C7H14/c1-8-9-16-32-24(5)26-14-15-29(27(21-26)33-31(36)30(22(2)3)25(6)37-7)35-19-17-34(18-20-35)28-13-11-10-12-23(28)4;1-4-5-6-7(2)3/h10-15,21,32H,2,5,8-9,16-20H2,1,3-4,6-7H3,(H,33,36);2,4-6H2,1,3H3/b30-25+; |
| InChIKey | SFPCOSRBNBKRGR-KEDMHLQRSA-N |
| XLogP | 9.59 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|