C33H43N5O5 — CID 71226617
tert-butyl N-[3-[[3-[(5-ethylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]propyl]carbamate (PubChem CID 71226617) has the molecular formula C33H43N5O5 and a molecular weight of 589.74 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-[(5-ethylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-[(5-ethylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 71226617 |
| Molecular Formula | C33H43N5O5 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.33 |
| IUPAC Name | tert-butyl N-[3-[[3-[(5-ethylfuran-2-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]propyl]carbamate |
| SMILES | CCc1ccc(C(=O)Nc2cc(C(=O)NCCCNC(=O)OC(C)(C)C)ccc2N2CCN(c3ccccc3C)CC2)o1 |
| InChI | InChI=1S/C33H43N5O5/c1-6-25-13-15-29(42-25)31(40)36-26-22-24(30(39)34-16-9-17-35-32(41)43-33(3,4)5)12-14-28(26)38-20-18-37(19-21-38)27-11-8-7-10-23(27)2/h7-8,10-15,22H,6,9,16-21H2,1-5H3,(H,34,39)(H,35,41)(H,36,40) |
| InChIKey | PSDLBBJZCBUDJU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|