C34H44N6O4 — CID 71234414
N-[5-[3-(cyclohexylmethylcarbamoylamino)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 71234414) has the molecular formula C34H44N6O4 and a molecular weight of 600.76 g/mol. Its IUPAC name is N-[5-[3-(cyclohexylmethylcarbamoylamino)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-[3-(cyclohexylmethylcarbamoylamino)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71234414 |
| Molecular Formula | C34H44N6O4 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | N-[5-[3-(cyclohexylmethylcarbamoylamino)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1N1CCN(c2ccc(C(=O)NCCCNC(=O)NCC3CCCCC3)cc2NC(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C34H44N6O4/c1-25-9-5-6-12-29(25)39-18-20-40(21-19-39)30-15-14-27(23-28(30)38-33(42)31-13-7-22-44-31)32(41)35-16-8-17-36-34(43)37-24-26-10-3-2-4-11-26/h5-7,9,12-15,22-23,26H,2-4,8,10-11,16-21,24H2,1H3,(H,35,41)(H,38,42)(H2,36,37,43) |
| InChIKey | HWUOGENQQFPOGM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|