C30H34N6O6 — CID 126498858
N-[5-[3-(2-hydroxy-3-methyl-4,5-dioxoimidazolidin-1-yl)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 126498858) has the molecular formula C30H34N6O6 and a molecular weight of 574.64 g/mol. Its IUPAC name is N-[5-[3-(2-hydroxy-3-methyl-4,5-dioxoimidazolidin-1-yl)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-[3-(2-hydroxy-3-methyl-4,5-dioxoimidazolidin-1-yl)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126498858 |
| Molecular Formula | C30H34N6O6 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | N-[5-[3-(2-hydroxy-3-methyl-4,5-dioxoimidazolidin-1-yl)propylcarbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1N1CCN(c2ccc(C(=O)NCCCN3C(=O)C(=O)N(C)C3O)cc2NC(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C30H34N6O6/c1-20-7-3-4-8-23(20)34-14-16-35(17-15-34)24-11-10-21(19-22(24)32-27(38)25-9-5-18-42-25)26(37)31-12-6-13-36-29(40)28(39)33(2)30(36)41/h3-5,7-11,18-19,30,41H,6,12-17H2,1-2H3,(H,31,37)(H,32,38) |
| InChIKey | HJZAUECNYSAHGP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|