About 1-butyl-4-methylpiperazine;ethane;2-methylpyridine
1-butyl-4-methylpiperazine;ethane;2-methylpyridine (PubChem CID 144514964) has the molecular formula C17H33N3
and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-butyl-4-methylpiperazine;ethane;2-methylpyridine.
Molecular Properties
| Compound Name | 1-butyl-4-methylpiperazine;ethane;2-methylpyridine |
| PubChem CID | 144514964 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 1-butyl-4-methylpiperazine;ethane;2-methylpyridine |
| SMILES | CC.CCCCN1CCN(C)CC1.Cc1ccccn1 |
| InChI | InChI=1S/C9H20N2.C6H7N.C2H6/c1-3-4-5-11-8-6-10(2)7-9-11;1-6-4-2-3-5-7-6;1-2/h3-9H2,1-2H3;2-5H,1H3;1-2H3 |
| InChIKey | UIBOUPPFVAKHFG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-4-methylpiperazine;ethane;2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-methylpiperazine;ethane;2-methylpyridine?
The IUPAC name of 1-butyl-4-methylpiperazine;ethane;2-methylpyridine (CID 144514964) is 1-butyl-4-methylpiperazine;ethane;2-methylpyridine.
What is the SMILES notation for 1-butyl-4-methylpiperazine;ethane;2-methylpyridine?
The canonical SMILES for 1-butyl-4-methylpiperazine;ethane;2-methylpyridine is CC.CCCCN1CCN(C)CC1.Cc1ccccn1.
What is the InChIKey of 1-butyl-4-methylpiperazine;ethane;2-methylpyridine?
The InChIKey is UIBOUPPFVAKHFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2.C6H7N.C2H6/c1-3-4-5-11-8-6-10(2)7-9-11;1-6-4-2-3-5-7-6;1-2/h3-9H2,1-2H3;2-5H,1H3;1-2H3.
What are the key properties of 1-butyl-4-methylpiperazine;ethane;2-methylpyridine?
1-butyl-4-methylpiperazine;ethane;2-methylpyridine has a molecular weight of 279.47 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methylpiperazine;ethane;2-methylpyridine is sourced from PubChem (CID 144514964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).