C11H17NO — CID 144515134
ethane;(3E)-1-imino-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one (PubChem CID 144515134) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;(3E)-1-imino-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one.
| Compound Name | ethane;(3E)-1-imino-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 144515134 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;(3E)-1-imino-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one |
| SMILES | CC.[H]/N=C/C(=O)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C9H11NO.C2H6/c1-3-5-8(6-4-2)9(11)7-10;1-2/h3-7,10H,1H2,2H3;1-2H3/b6-4-,8-5+,10-7+; |
| InChIKey | NLDBLMPURRMSSC-XLNSPYIUSA-N |
| XLogP | 2.92 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|