C17H31BINO4S — CID 144515521
iodo(methylsulfanyl)borinic acid;3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N-prop-2-enylpropanamide (PubChem CID 144515521) has the molecular formula C17H31BINO4S and a molecular weight of 483.22 g/mol. Its IUPAC name is iodo(methylsulfanyl)borinic acid;3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N-prop-2-enylpropanamide.
| Compound Name | iodo(methylsulfanyl)borinic acid;3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 144515521 |
| Molecular Formula | C17H31BINO4S |
| Molecular Weight | 483.22 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | iodo(methylsulfanyl)borinic acid;3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)CCOC/C(C)=C\CCC(C=C)OC.CSB(O)I |
| InChI | InChI=1S/C16H27NO3.CH4BIOS/c1-5-11-17-16(18)10-12-20-13-14(3)8-7-9-15(6-2)19-4;1-5-2(3)4/h5-6,8,15H,1-2,7,9-13H2,3-4H3,(H,17,18);4H,1H3/b14-8-; |
| InChIKey | XHOUMFHZIZGRQC-ZXDBEMHSSA-N |
| XLogP | 3.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|