C14H23NO3 — CID 144515520
(7E,12Z)-9-methoxy-13-methyl-1-oxa-5-azacyclotetradeca-7,12-dien-4-one (PubChem CID 144515520) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (7E,12Z)-9-methoxy-13-methyl-1-oxa-5-azacyclotetradeca-7,12-dien-4-one.
| Compound Name | (7E,12Z)-9-methoxy-13-methyl-1-oxa-5-azacyclotetradeca-7,12-dien-4-one |
|---|---|
| PubChem CID | 144515520 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (7E,12Z)-9-methoxy-13-methyl-1-oxa-5-azacyclotetradeca-7,12-dien-4-one |
| SMILES | COC1/C=C/CNC(=O)CCOC/C(C)=C\CC1 |
| InChI | InChI=1S/C14H23NO3/c1-12-5-3-6-13(17-2)7-4-9-15-14(16)8-10-18-11-12/h4-5,7,13H,3,6,8-11H2,1-2H3,(H,15,16)/b7-4+,12-5- |
| InChIKey | OVRSRKNXXPWNMF-MIVQSLJFSA-N |
| XLogP | 1.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|