C12H21NO2 — CID 11241295
2-(2,5-dihydrofuran-2-yl)-N-hexylacetamide (PubChem CID 11241295) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-(2,5-dihydrofuran-2-yl)-N-hexylacetamide.
| Compound Name | 2-(2,5-dihydrofuran-2-yl)-N-hexylacetamide |
|---|---|
| PubChem CID | 11241295 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-(2,5-dihydrofuran-2-yl)-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CC1C=CCO1 |
| InChI | InChI=1S/C12H21NO2/c1-2-3-4-5-8-13-12(14)10-11-7-6-9-15-11/h6-7,11H,2-5,8-10H2,1H3,(H,13,14) |
| InChIKey | AHDOIGLLOLODBM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|