C10H17NO2 — CID 101253880
N-butyl-2-(2,5-dihydrofuran-2-yl)acetamide (PubChem CID 101253880) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-butyl-2-(2,5-dihydrofuran-2-yl)acetamide.
| Compound Name | N-butyl-2-(2,5-dihydrofuran-2-yl)acetamide |
|---|---|
| PubChem CID | 101253880 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-butyl-2-(2,5-dihydrofuran-2-yl)acetamide |
| SMILES | CCCCNC(=O)CC1C=CCO1 |
| InChI | InChI=1S/C10H17NO2/c1-2-3-6-11-10(12)8-9-5-4-7-13-9/h4-5,9H,2-3,6-8H2,1H3,(H,11,12) |
| InChIKey | FIWIQPKEXDBUCO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|