C12H23NO2 — CID 123378652
3-methoxy-2-methyl-N-(2-methylpropyl)hex-4-enamide (PubChem CID 123378652) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-methoxy-2-methyl-N-(2-methylpropyl)hex-4-enamide.
| Compound Name | 3-methoxy-2-methyl-N-(2-methylpropyl)hex-4-enamide |
|---|---|
| PubChem CID | 123378652 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3-methoxy-2-methyl-N-(2-methylpropyl)hex-4-enamide |
| SMILES | CC=CC(OC)C(C)C(=O)NCC(C)C |
| InChI | InChI=1S/C12H23NO2/c1-6-7-11(15-5)10(4)12(14)13-8-9(2)3/h6-7,9-11H,8H2,1-5H3,(H,13,14) |
| InChIKey | AGNWVFIPLHAFSM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|