C16H31NO2 — CID 153306596
(E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide (PubChem CID 153306596) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide.
| Compound Name | (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide |
|---|---|
| PubChem CID | 153306596 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide |
| SMILES | CC(C)CNC(=O)C(C)(C)C/C=C/COCC(C)C |
| InChI | InChI=1S/C16H31NO2/c1-13(2)11-17-15(18)16(5,6)9-7-8-10-19-12-14(3)4/h7-8,13-14H,9-12H2,1-6H3,(H,17,18)/b8-7+ |
| InChIKey | IVHWBQFOYIIQBZ-BQYQJAHWSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|