About (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide
(E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide (PubChem CID 153306596) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide.
Molecular Properties
| Compound Name | (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide |
| PubChem CID | 153306596 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide |
| SMILES | CC(C)CNC(=O)C(C)(C)C/C=C/COCC(C)C |
| InChI | InChI=1S/C16H31NO2/c1-13(2)11-17-15(18)16(5,6)9-7-8-10-19-12-14(3)4/h7-8,13-14H,9-12H2,1-6H3,(H,17,18)/b8-7+ |
| InChIKey | IVHWBQFOYIIQBZ-BQYQJAHWSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide?
The IUPAC name of (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide (CID 153306596) is (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide.
What is the SMILES notation for (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide?
The canonical SMILES for (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide is CC(C)CNC(=O)C(C)(C)C/C=C/COCC(C)C.
What is the InChIKey of (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide?
The InChIKey is IVHWBQFOYIIQBZ-BQYQJAHWSA-N. The full InChI is InChI=1S/C16H31NO2/c1-13(2)11-17-15(18)16(5,6)9-7-8-10-19-12-14(3)4/h7-8,13-14H,9-12H2,1-6H3,(H,17,18)/b8-7+.
What are the key properties of (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide?
(E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide has a molecular weight of 269.43 g/mol, XLogP of 3.40, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,2-dimethyl-6-(2-methylpropoxy)-N-(2-methylpropyl)hex-4-enamide is sourced from PubChem (CID 153306596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).