C13H23NO3 — CID 146168828
ethyl (E)-5,5-dimethyl-6-oxo-6-(propan-2-ylamino)hex-2-enoate (PubChem CID 146168828) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl (E)-5,5-dimethyl-6-oxo-6-(propan-2-ylamino)hex-2-enoate.
| Compound Name | ethyl (E)-5,5-dimethyl-6-oxo-6-(propan-2-ylamino)hex-2-enoate |
|---|---|
| PubChem CID | 146168828 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethyl (E)-5,5-dimethyl-6-oxo-6-(propan-2-ylamino)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/CC(C)(C)C(=O)NC(C)C |
| InChI | InChI=1S/C13H23NO3/c1-6-17-11(15)8-7-9-13(4,5)12(16)14-10(2)3/h7-8,10H,6,9H2,1-5H3,(H,14,16)/b8-7+ |
| InChIKey | FBBQBYOYRJMOOI-BQYQJAHWSA-N |
| XLogP | 2.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|