C13H24N2O3 — CID 5364159
ethyl (E)-4-(2-aminopropanoylamino)-6-methylhept-2-enoate (PubChem CID 5364159) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is ethyl (E)-4-(2-aminopropanoylamino)-6-methylhept-2-enoate.
| Compound Name | ethyl (E)-4-(2-aminopropanoylamino)-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 5364159 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethyl (E)-4-(2-aminopropanoylamino)-6-methylhept-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CC(C)C)NC(=O)C(C)N |
| InChI | InChI=1S/C13H24N2O3/c1-5-18-12(16)7-6-11(8-9(2)3)15-13(17)10(4)14/h6-7,9-11H,5,8,14H2,1-4H3,(H,15,17)/b7-6+ |
| InChIKey | SYQGXONIFZPWHI-VOTSOKGWSA-N |
| XLogP | 0.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|