C15H27NO4 — CID 5365141
ethyl (E)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate (PubChem CID 5365141) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl (E)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate.
| Compound Name | ethyl (E)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
|---|---|
| PubChem CID | 5365141 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethyl (E)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-7-19-13(17)9-8-12(10-11(2)3)16-14(18)20-15(4,5)6/h8-9,11-12H,7,10H2,1-6H3,(H,16,18)/b9-8+ |
| InChIKey | MZMHSVLFRKOOTG-CMDGGOBGSA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|