C14H23NO2 — CID 144515544
(6E,11Z)-8-methoxy-12-methyl-1-azacyclotrideca-6,11-dien-2-one (PubChem CID 144515544) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (6E,11Z)-8-methoxy-12-methyl-1-azacyclotrideca-6,11-dien-2-one.
| Compound Name | (6E,11Z)-8-methoxy-12-methyl-1-azacyclotrideca-6,11-dien-2-one |
|---|---|
| PubChem CID | 144515544 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (6E,11Z)-8-methoxy-12-methyl-1-azacyclotrideca-6,11-dien-2-one |
| SMILES | COC1/C=C/CCCC(=O)NC/C(C)=C\CC1 |
| InChI | InChI=1S/C14H23NO2/c1-12-7-6-9-13(17-2)8-4-3-5-10-14(16)15-11-12/h4,7-8,13H,3,5-6,9-11H2,1-2H3,(H,15,16)/b8-4+,12-7- |
| InChIKey | KWVLGMKLWBZERV-LLZLKJDISA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|