C11H17NO2 — CID 142386187
(5Z)-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide (PubChem CID 142386187) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (5Z)-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide.
| Compound Name | (5Z)-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide |
|---|---|
| PubChem CID | 142386187 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (5Z)-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide |
| SMILES | C=C(/C=C\C(=C)OC)CCC(=O)NC |
| InChI | InChI=1S/C11H17NO2/c1-9(5-7-10(2)14-4)6-8-11(13)12-3/h5,7H,1-2,6,8H2,3-4H3,(H,12,13)/b7-5- |
| InChIKey | PCLYAJHXEWHZPQ-ALCCZGGFSA-N |
| XLogP | 1.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|