C14H25NO2 — CID 142275229
N-[(3Z,5E)-5-methoxy-2-methylocta-3,5-dienyl]butanamide (PubChem CID 142275229) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(3Z,5E)-5-methoxy-2-methylocta-3,5-dienyl]butanamide.
| Compound Name | N-[(3Z,5E)-5-methoxy-2-methylocta-3,5-dienyl]butanamide |
|---|---|
| PubChem CID | 142275229 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-[(3Z,5E)-5-methoxy-2-methylocta-3,5-dienyl]butanamide |
| SMILES | CC/C=C(\C=C/C(C)CNC(=O)CCC)OC |
| InChI | InChI=1S/C14H25NO2/c1-5-7-13(17-4)10-9-12(3)11-15-14(16)8-6-2/h7,9-10,12H,5-6,8,11H2,1-4H3,(H,15,16)/b10-9-,13-7+ |
| InChIKey | KFPCJMGXVZIYMA-QLNUPNCESA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|