C12H19NO3 — CID 123880567
N-(6,7-dimethoxynona-4,6,8-trienyl)formamide (PubChem CID 123880567) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(6,7-dimethoxynona-4,6,8-trienyl)formamide.
| Compound Name | N-(6,7-dimethoxynona-4,6,8-trienyl)formamide |
|---|---|
| PubChem CID | 123880567 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | N-(6,7-dimethoxynona-4,6,8-trienyl)formamide |
| SMILES | C=CC(OC)=C(C=CCCCNC=O)OC |
| InChI | InChI=1S/C12H19NO3/c1-4-11(15-2)12(16-3)8-6-5-7-9-13-10-14/h4,6,8,10H,1,5,7,9H2,2-3H3,(H,13,14) |
| InChIKey | ATSUQZZBCPIVMP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|