C10H17NO — CID 143112726
(3Z,5E)-5-methoxy-N-methylocta-3,5,7-trien-1-amine (PubChem CID 143112726) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (3Z,5E)-5-methoxy-N-methylocta-3,5,7-trien-1-amine.
| Compound Name | (3Z,5E)-5-methoxy-N-methylocta-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 143112726 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3Z,5E)-5-methoxy-N-methylocta-3,5,7-trien-1-amine |
| SMILES | C=C/C=C(\C=C/CCNC)OC |
| InChI | InChI=1S/C10H17NO/c1-4-7-10(12-3)8-5-6-9-11-2/h4-5,7-8,11H,1,6,9H2,2-3H3/b8-5-,10-7+ |
| InChIKey | XPYSRSWXWRWKRW-OEPUHGBTSA-N |
| XLogP | 1.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|