C10H19NO — CID 90755052
6-methoxynona-4,6-dien-2-amine (PubChem CID 90755052) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 6-methoxynona-4,6-dien-2-amine.
| Compound Name | 6-methoxynona-4,6-dien-2-amine |
|---|---|
| PubChem CID | 90755052 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 6-methoxynona-4,6-dien-2-amine |
| SMILES | CCC=C(C=CCC(C)N)OC |
| InChI | InChI=1S/C10H19NO/c1-4-6-10(12-3)8-5-7-9(2)11/h5-6,8-9H,4,7,11H2,1-3H3 |
| InChIKey | XGKFPXLSDALITH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|