C10H17NO — CID 57009658
1-(3,4-dihydro-2H-oxepin-7-ylidene)butan-2-amine (PubChem CID 57009658) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-oxepin-7-ylidene)butan-2-amine.
| Compound Name | 1-(3,4-dihydro-2H-oxepin-7-ylidene)butan-2-amine |
|---|---|
| PubChem CID | 57009658 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-oxepin-7-ylidene)butan-2-amine |
| SMILES | CCC(N)C=C1C=CCCCO1 |
| InChI | InChI=1S/C10H17NO/c1-2-9(11)8-10-6-4-3-5-7-12-10/h4,6,8-9H,2-3,5,7,11H2,1H3 |
| InChIKey | VRFPUAKSYROXNH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |