C10H18FNO — CID 145312320
(3Z,5E)-5-fluoro-7-propan-2-yloxyhepta-3,5-dien-2-amine (PubChem CID 145312320) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is (3Z,5E)-5-fluoro-7-propan-2-yloxyhepta-3,5-dien-2-amine.
| Compound Name | (3Z,5E)-5-fluoro-7-propan-2-yloxyhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 145312320 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3Z,5E)-5-fluoro-7-propan-2-yloxyhepta-3,5-dien-2-amine |
| SMILES | CC(N)/C=C\C(F)=C/COC(C)C |
| InChI | InChI=1S/C10H18FNO/c1-8(2)13-7-6-10(11)5-4-9(3)12/h4-6,8-9H,7,12H2,1-3H3/b5-4-,10-6+ |
| InChIKey | FXVAMBKWCKFMER-VWJYOPCBSA-N |
| XLogP | 2.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|