C11H18F3NO — CID 163869876
(3Z,5Z)-5-(3,3,3-trifluoropropoxy)octa-3,5-dien-2-amine (PubChem CID 163869876) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is (3Z,5Z)-5-(3,3,3-trifluoropropoxy)octa-3,5-dien-2-amine.
| Compound Name | (3Z,5Z)-5-(3,3,3-trifluoropropoxy)octa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 163869876 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (3Z,5Z)-5-(3,3,3-trifluoropropoxy)octa-3,5-dien-2-amine |
| SMILES | CC/C=C(/C=C\C(C)N)OCCC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO/c1-3-4-10(6-5-9(2)15)16-8-7-11(12,13)14/h4-6,9H,3,7-8,15H2,1-2H3/b6-5-,10-4- |
| InChIKey | PJWFNNCZYXAOGL-ZQWSEWHOSA-N |
| XLogP | 3.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|